C16H26FNO — CID 166556145
(1S)-2-[(2Z,6E)-6-fluorocyclonona-2,6-dien-1-yl]-2-(methylamino)cyclohexan-1-ol (PubChem CID 166556145) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is (1S)-2-[(2Z,6E)-6-fluorocyclonona-2,6-dien-1-yl]-2-(methylamino)cyclohexan-1-ol.
| Compound Name | (1S)-2-[(2Z,6E)-6-fluorocyclonona-2,6-dien-1-yl]-2-(methylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 166556145 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (1S)-2-[(2Z,6E)-6-fluorocyclonona-2,6-dien-1-yl]-2-(methylamino)cyclohexan-1-ol |
| SMILES | CNC1(C2/C=C\CC/C(F)=C\CC2)CCCC[C@@H]1O |
| InChI | InChI=1S/C16H26FNO/c1-18-16(12-5-4-11-15(16)19)13-7-2-3-9-14(17)10-6-8-13/h2,7,10,13,15,18-19H,3-6,8-9,11-12H2,1H3/b7-2-,14-10+/t13?,15-,16?/m0/s1 |
| InChIKey | YWSKNTNPILVCHH-FOBCPRASSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|