About CID 166556218
CID 166556218 (PubChem CID 166556218) has the molecular formula C23H19F3N4O2Si
and a molecular weight of 468.51 g/mol.
Molecular Properties
| Compound Name | CID 166556218 |
| PubChem CID | 166556218 |
| Molecular Formula | C23H19F3N4O2Si |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[Si][C@](c2cccc(-c3nc4cc(C=O)cc(C(F)(F)F)c4o3)c2)(c2nncn2C)C1 |
| InChI | InChI=1S/C23H19F3N4O2Si/c1-13-9-22(33-11-13,21-29-27-12-30(21)2)16-5-3-4-15(8-16)20-28-18-7-14(10-31)6-17(19(18)32-20)23(24,25)26/h3-8,10,12-13H,9,11H2,1-2H3/t13-,22+/m0/s1 |
| InChIKey | XRTHFPPFUNSADP-WHEQGISXSA-N |
| XLogP | 4.86 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166556218 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166556218?
The IUPAC name of CID 166556218 (CID 166556218) is not available.
What is the SMILES notation for CID 166556218?
The canonical SMILES for CID 166556218 is C[C@@H]1C[Si][C@](c2cccc(-c3nc4cc(C=O)cc(C(F)(F)F)c4o3)c2)(c2nncn2C)C1.
What is the InChIKey of CID 166556218?
The InChIKey is XRTHFPPFUNSADP-WHEQGISXSA-N. The full InChI is InChI=1S/C23H19F3N4O2Si/c1-13-9-22(33-11-13,21-29-27-12-30(21)2)16-5-3-4-15(8-16)20-28-18-7-14(10-31)6-17(19(18)32-20)23(24,25)26/h3-8,10,12-13H,9,11H2,1-2H3/t13-,22+/m0/s1.
What are the key properties of CID 166556218?
CID 166556218 has a molecular weight of 468.51 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166556218 is sourced from PubChem (CID 166556218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).