C29H24F5N5O — CID 166556326
N-(cyclobutylmethyl)-2,2,2-trifluoro-1-[7-fluoro-2-[3-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]phenyl]-1,3-benzoxazol-5-yl]ethanamine (PubChem CID 166556326) has the molecular formula C29H24F5N5O and a molecular weight of 553.54 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,2,2-trifluoro-1-[7-fluoro-2-[3-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]phenyl]-1,3-benzoxazol-5-yl]ethanamine.
| Compound Name | N-(cyclobutylmethyl)-2,2,2-trifluoro-1-[7-fluoro-2-[3-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]phenyl]-1,3-benzoxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 166556326 |
| Molecular Formula | C29H24F5N5O |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-(cyclobutylmethyl)-2,2,2-trifluoro-1-[7-fluoro-2-[3-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]phenyl]-1,3-benzoxazol-5-yl]ethanamine |
| SMILES | Cn1cnnc1-c1cc(F)ccc1-c1cccc(-c2nc3cc(C(NCC4CCC4)C(F)(F)F)cc(F)c3o2)c1 |
| InChI | InChI=1S/C29H24F5N5O/c1-39-15-36-38-27(39)22-13-20(30)8-9-21(22)17-6-3-7-18(10-17)28-37-24-12-19(11-23(31)25(24)40-28)26(29(32,33)34)35-14-16-4-2-5-16/h3,6-13,15-16,26,35H,2,4-5,14H2,1H3 |
| InChIKey | GEBQSDWGYNTWAH-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |