C8H12O4 — CID 16655648
(1S,2R,5S,6R)-5,6-dihydroxy-2-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 16655648) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (1S,2R,5S,6R)-5,6-dihydroxy-2-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,2R,5S,6R)-5,6-dihydroxy-2-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 16655648 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1S,2R,5S,6R)-5,6-dihydroxy-2-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | C[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-4-2-3-5(9)7(10)6(4)8(11)12/h2-7,9-10H,1H3,(H,11,12)/t4-,5+,6+,7+/m1/s1 |
| InChIKey | RHXXZFQMAAFQOC-BWBBJGPYSA-N |
| XLogP | -0.39 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|