About 4-indol-1-ylphenol
4-indol-1-ylphenol (PubChem CID 16655672) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-indol-1-ylphenol.
Molecular Properties
| Compound Name | 4-indol-1-ylphenol |
| PubChem CID | 16655672 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-indol-1-ylphenol |
| SMILES | Oc1ccc(-n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C14H11NO/c16-13-7-5-12(6-8-13)15-10-9-11-3-1-2-4-14(11)15/h1-10,16H |
| InChIKey | NCLYASZGRPCNLM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-indol-1-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-indol-1-ylphenol?
The IUPAC name of 4-indol-1-ylphenol (CID 16655672) is 4-indol-1-ylphenol.
What is the SMILES notation for 4-indol-1-ylphenol?
The canonical SMILES for 4-indol-1-ylphenol is Oc1ccc(-n2ccc3ccccc32)cc1.
What is the InChIKey of 4-indol-1-ylphenol?
The InChIKey is NCLYASZGRPCNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c16-13-7-5-12(6-8-13)15-10-9-11-3-1-2-4-14(11)15/h1-10,16H.
What are the key properties of 4-indol-1-ylphenol?
4-indol-1-ylphenol has a molecular weight of 209.25 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-indol-1-ylphenol is sourced from PubChem (CID 16655672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).