C22H19F3N4O2Si — CID 166557016
2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)siletan-1-yl]phenyl]-7-(trifluoromethyl)-1,3-benzoxazole-5-carbaldehyde (PubChem CID 166557016) has the molecular formula C22H19F3N4O2Si and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)siletan-1-yl]phenyl]-7-(trifluoromethyl)-1,3-benzoxazole-5-carbaldehyde.
| Compound Name | 2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)siletan-1-yl]phenyl]-7-(trifluoromethyl)-1,3-benzoxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 166557016 |
| Molecular Formula | C22H19F3N4O2Si |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)siletan-1-yl]phenyl]-7-(trifluoromethyl)-1,3-benzoxazole-5-carbaldehyde |
| SMILES | CC1C[Si](c2cccc(-c3nc4cc(C=O)cc(C(F)(F)F)c4o3)c2)(c2nncn2C)C1 |
| InChI | InChI=1S/C22H19F3N4O2Si/c1-13-10-32(11-13,21-28-26-12-29(21)2)16-5-3-4-15(8-16)20-27-18-7-14(9-30)6-17(19(18)31-20)22(23,24)25/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | LUQBUKJWXYIQNP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|