C26H20F3N5O3 — CID 166557736
6-cyclopropyl-N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide (PubChem CID 166557736) has the molecular formula C26H20F3N5O3 and a molecular weight of 507.47 g/mol. Its IUPAC name is 6-cyclopropyl-N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166557736 |
| Molecular Formula | C26H20F3N5O3 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 6-cyclopropyl-N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxamide |
| SMILES | Cn1cnnc1-c1ccccc1-c1cc(C(=O)Nc2cc(C=O)cc(C(F)(F)F)c2O)nc(C2CC2)c1 |
| InChI | InChI=1S/C26H20F3N5O3/c1-34-13-30-33-24(34)18-5-3-2-4-17(18)16-10-20(15-6-7-15)31-22(11-16)25(37)32-21-9-14(12-35)8-19(23(21)36)26(27,28)29/h2-5,8-13,15,36H,6-7H2,1H3,(H,32,37) |
| InChIKey | HEGJAQHHMKJUCT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|