About ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole
ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole (PubChem CID 166557807) has the molecular formula C12H22N2S
and a molecular weight of 226.39 g/mol. Its IUPAC name is ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole |
| PubChem CID | 166557807 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole |
| SMILES | CC.CC1CCCC(c2nncs2)CC1 |
| InChI | InChI=1S/C10H16N2S.C2H6/c1-8-3-2-4-9(6-5-8)10-12-11-7-13-10;1-2/h7-9H,2-6H2,1H3;1-2H3 |
| InChIKey | NRRKKYXXFAWHIX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole?
The IUPAC name of ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole (CID 166557807) is ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole.
What is the SMILES notation for ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole?
The canonical SMILES for ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole is CC.CC1CCCC(c2nncs2)CC1.
What is the InChIKey of ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole?
The InChIKey is NRRKKYXXFAWHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S.C2H6/c1-8-3-2-4-9(6-5-8)10-12-11-7-13-10;1-2/h7-9H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole?
ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole has a molecular weight of 226.39 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methylcycloheptyl)-1,3,4-thiadiazole is sourced from PubChem (CID 166557807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).