C17H21F3N2O4 — CID 166557943
[(1-hydroxycyclobutyl)methylamino]-[2-propan-2-yl-7-(trifluoromethyl)-1,3-benzoxazol-5-yl]methanediol (PubChem CID 166557943) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is [(1-hydroxycyclobutyl)methylamino]-[2-propan-2-yl-7-(trifluoromethyl)-1,3-benzoxazol-5-yl]methanediol.
| Compound Name | [(1-hydroxycyclobutyl)methylamino]-[2-propan-2-yl-7-(trifluoromethyl)-1,3-benzoxazol-5-yl]methanediol |
|---|---|
| PubChem CID | 166557943 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(1-hydroxycyclobutyl)methylamino]-[2-propan-2-yl-7-(trifluoromethyl)-1,3-benzoxazol-5-yl]methanediol |
| SMILES | CC(C)c1nc2cc(C(O)(O)NCC3(O)CCC3)cc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C17H21F3N2O4/c1-9(2)14-22-12-7-10(6-11(13(12)26-14)16(18,19)20)17(24,25)21-8-15(23)4-3-5-15/h6-7,9,21,23-25H,3-5,8H2,1-2H3 |
| InChIKey | QHVJVVDTTDRZFH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|