C19H26F2N6O2 — CID 166559157
3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 166559157) has the molecular formula C19H26F2N6O2 and a molecular weight of 408.45 g/mol. Its IUPAC name is 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166559157 |
| Molecular Formula | C19H26F2N6O2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(C4CCNCC4(F)F)CC3)cn2)C(=O)N1 |
| InChI | InChI=1S/C19H26F2N6O2/c20-19(21)12-22-6-5-15(19)27-9-7-26(8-10-27)13-1-3-16(23-11-13)24-14-2-4-17(28)25-18(14)29/h1,3,11,14-15,22H,2,4-10,12H2,(H,23,24)(H,25,28,29) |
| InChIKey | IJHMFDIGDIZUSB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|