C24H24FN7O — CID 166559793
3-(cyclopropylmethyl)-16-fluoro-5,10-dimethyl-20-oxa-3,4,9,10,11,23-hexazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine (PubChem CID 166559793) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-16-fluoro-5,10-dimethyl-20-oxa-3,4,9,10,11,23-hexazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine.
| Compound Name | 3-(cyclopropylmethyl)-16-fluoro-5,10-dimethyl-20-oxa-3,4,9,10,11,23-hexazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine |
|---|---|
| PubChem CID | 166559793 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-(cyclopropylmethyl)-16-fluoro-5,10-dimethyl-20-oxa-3,4,9,10,11,23-hexazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine |
| SMILES | Cc1nn(CC2CC2)c2c1Cc1nn(C)nc1-c1ccc(F)cc1COc1cc-2cnc1N |
| InChI | InChI=1S/C24H24FN7O/c1-13-19-9-20-22(30-31(2)29-20)18-6-5-17(25)7-16(18)12-33-21-8-15(10-27-24(21)26)23(19)32(28-13)11-14-3-4-14/h5-8,10,14H,3-4,9,11-12H2,1-2H3,(H2,26,27) |
| InChIKey | QLDOSXSTPCJKNN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|