C21H18BrFN6O4 — CID 166559811
5-[[5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,2,4-triazol-1-yl]methyl]-3-ethyl-1,2-oxazole (PubChem CID 166559811) has the molecular formula C21H18BrFN6O4 and a molecular weight of 517.32 g/mol. Its IUPAC name is 5-[[5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,2,4-triazol-1-yl]methyl]-3-ethyl-1,2-oxazole.
| Compound Name | 5-[[5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,2,4-triazol-1-yl]methyl]-3-ethyl-1,2-oxazole |
|---|---|
| PubChem CID | 166559811 |
| Molecular Formula | C21H18BrFN6O4 |
| Molecular Weight | 517.32 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 5-[[5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,2,4-triazol-1-yl]methyl]-3-ethyl-1,2-oxazole |
| SMILES | CCc1cc(Cn2ncnc2-c2ccc(F)cc2C(C)Oc2cc(Br)cnc2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C21H18BrFN6O4/c1-3-15-8-16(33-27-15)10-28-20(25-11-26-28)17-5-4-14(23)7-18(17)12(2)32-19-6-13(22)9-24-21(19)29(30)31/h4-9,11-12H,3,10H2,1-2H3 |
| InChIKey | HXBMHKAUJLRRRG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|