About (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol
(5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol (PubChem CID 166560003) has the molecular formula C9H6BrN3OS
and a molecular weight of 284.14 g/mol. Its IUPAC name is (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol.
Molecular Properties
| Compound Name | (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol |
| PubChem CID | 166560003 |
| Molecular Formula | C9H6BrN3OS |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol |
| SMILES | C#Cc1cc(C(O)c2ncsc2Br)n[nH]1 |
| InChI | InChI=1S/C9H6BrN3OS/c1-2-5-3-6(13-12-5)8(14)7-9(10)15-4-11-7/h1,3-4,8,14H,(H,12,13) |
| InChIKey | OQZQUEAWZFIRBE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol?
The IUPAC name of (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol (CID 166560003) is (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol.
What is the SMILES notation for (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol?
The canonical SMILES for (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol is C#Cc1cc(C(O)c2ncsc2Br)n[nH]1.
What is the InChIKey of (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol?
The InChIKey is OQZQUEAWZFIRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrN3OS/c1-2-5-3-6(13-12-5)8(14)7-9(10)15-4-11-7/h1,3-4,8,14H,(H,12,13).
What are the key properties of (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol?
(5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol has a molecular weight of 284.14 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-1,3-thiazol-4-yl)-(5-ethynyl-1H-pyrazol-3-yl)methanol is sourced from PubChem (CID 166560003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).