C25H34N4O2 — CID 166560557
3-[4-[(2,3-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-yl)amino]piperidin-1-yl]propanenitrile (PubChem CID 166560557) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3-[4-[(2,3-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-yl)amino]piperidin-1-yl]propanenitrile.
| Compound Name | 3-[4-[(2,3-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-yl)amino]piperidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 166560557 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[4-[(2,3-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-yl)amino]piperidin-1-yl]propanenitrile |
| SMILES | COc1cc2nc3c(c(NC4CCN(CCC#N)CC4)c2cc1OC)CCCCCC3 |
| InChI | InChI=1S/C25H34N4O2/c1-30-23-16-20-22(17-24(23)31-2)28-21-9-6-4-3-5-8-19(21)25(20)27-18-10-14-29(15-11-18)13-7-12-26/h16-18H,3-11,13-15H2,1-2H3,(H,27,28) |
| InChIKey | MSXYXTVJZBEMKV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |