C11H20F2O2Si — CID 166561246
trans-(1R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorocyclopropane-1-carbaldehyde (PubChem CID 166561246) has the molecular formula C11H20F2O2Si and a molecular weight of 250.36 g/mol. Its IUPAC name is trans-(1R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorocyclopropane-1-carbaldehyde.
| Compound Name | trans-(1R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorocyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 166561246 |
| Molecular Formula | C11H20F2O2Si |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | trans-(1R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-difluorocyclopropane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](C=O)C1(F)F |
| InChI | InChI=1S/C11H20F2O2Si/c1-10(2,3)16(4,5)15-7-9-8(6-14)11(9,12)13/h6,8-9H,7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | CFSNMFQEPJQWCB-IUCAKERBSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|