About [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate
[(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate (PubChem CID 166561295) has the molecular formula C10H14F2O2
and a molecular weight of 204.22 g/mol. Its IUPAC name is [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate.
Molecular Properties
| Compound Name | [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate |
| PubChem CID | 166561295 |
| Molecular Formula | C10H14F2O2 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate |
| SMILES | C=CC[C@@H]1C(F)(F)[C@@]1(C)COC(C)=O |
| InChI | InChI=1S/C10H14F2O2/c1-4-5-8-9(3,10(8,11)12)6-14-7(2)13/h4,8H,1,5-6H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | WTVIYHSBXUSSEQ-IUCAKERBSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate?
The IUPAC name of [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate (CID 166561295) is [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate.
What is the SMILES notation for [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate?
The canonical SMILES for [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate is C=CC[C@@H]1C(F)(F)[C@@]1(C)COC(C)=O.
What is the InChIKey of [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate?
The InChIKey is WTVIYHSBXUSSEQ-IUCAKERBSA-N. The full InChI is InChI=1S/C10H14F2O2/c1-4-5-8-9(3,10(8,11)12)6-14-7(2)13/h4,8H,1,5-6H2,2-3H3/t8-,9-/m0/s1.
What are the key properties of [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate?
[(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate has a molecular weight of 204.22 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-2,2-difluoro-1-methyl-3-prop-2-enylcyclopropyl]methyl acetate is sourced from PubChem (CID 166561295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).