C10H13BrN2OZn — CID 166561626
bromozinc(1+);2-methyl-5-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrimidine (PubChem CID 166561626) has the molecular formula C10H13BrN2OZn and a molecular weight of 322.52 g/mol. Its IUPAC name is bromozinc(1+);2-methyl-5-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrimidine.
| Compound Name | bromozinc(1+);2-methyl-5-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrimidine |
|---|---|
| PubChem CID | 166561626 |
| Molecular Formula | C10H13BrN2OZn |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | bromozinc(1+);2-methyl-5-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrimidine |
| SMILES | Cc1ncc(C2C[CH-]CCO2)cn1.[Zn+]Br |
| InChI | InChI=1S/C10H13N2O.BrH.Zn/c1-8-11-6-9(7-12-8)10-4-2-3-5-13-10;;/h2,6-7,10H,3-5H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | JEUVXUGTYMLTMI-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|