About [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane
[3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 166561912) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane |
| PubChem CID | 166561912 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cccc(COc2ncnc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-23-16-8-14-15(9-17(16)24-2)20-11-21-18(14)25-10-12-5-4-6-13(7-12)26(3,19)22/h4-9,11,19H,10H2,1-3H3 |
| InChIKey | DVDRGQJJBZUNGQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane?
The IUPAC name of [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane (CID 166561912) is [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane.
What is the SMILES notation for [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane?
The canonical SMILES for [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane is [H]N=S(C)(=O)c1cccc(COc2ncnc3cc(OC)c(OC)cc23)c1.
What is the InChIKey of [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane?
The InChIKey is DVDRGQJJBZUNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4S/c1-23-16-8-14-15(9-17(16)24-2)20-11-21-18(14)25-10-12-5-4-6-13(7-12)26(3,19)22/h4-9,11,19H,10H2,1-3H3.
What are the key properties of [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane?
[3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane has a molecular weight of 373.43 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(6,7-dimethoxyquinazolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane is sourced from PubChem (CID 166561912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).