About pyridin-2-olate;tetrabutylazanium
pyridin-2-olate;tetrabutylazanium (PubChem CID 16656196) has the molecular formula C21H40N2O
and a molecular weight of 336.56 g/mol. Its IUPAC name is pyridin-2-olate;tetrabutylazanium.
Molecular Properties
| Compound Name | pyridin-2-olate;tetrabutylazanium |
| PubChem CID | 16656196 |
| Molecular Formula | C21H40N2O |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.31 |
| IUPAC Name | pyridin-2-olate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[O-]c1ccccn1 |
| InChI | InChI=1S/C16H36N.C5H5NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-5-3-1-2-4-6-5/h5-16H2,1-4H3;1-4H,(H,6,7)/q+1;/p-1 |
| InChIKey | NUQLARMDVKUNPC-UHFFFAOYSA-M |
| XLogP | 5.16 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-olate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-olate;tetrabutylazanium?
The IUPAC name of pyridin-2-olate;tetrabutylazanium (CID 16656196) is pyridin-2-olate;tetrabutylazanium.
What is the SMILES notation for pyridin-2-olate;tetrabutylazanium?
The canonical SMILES for pyridin-2-olate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.[O-]c1ccccn1.
What is the InChIKey of pyridin-2-olate;tetrabutylazanium?
The InChIKey is NUQLARMDVKUNPC-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C5H5NO/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-5-3-1-2-4-6-5/h5-16H2,1-4H3;1-4H,(H,6,7)/q+1;/p-1.
What are the key properties of pyridin-2-olate;tetrabutylazanium?
pyridin-2-olate;tetrabutylazanium has a molecular weight of 336.56 g/mol, XLogP of 5.16, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-olate;tetrabutylazanium is sourced from PubChem (CID 16656196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).