About imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane
imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane (PubChem CID 166562014) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane |
| PubChem CID | 166562014 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cccc(COc2ncnc3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C17H17N3O3S/c1-22-13-6-7-15-16(9-13)19-11-20-17(15)23-10-12-4-3-5-14(8-12)24(2,18)21/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | YVJQJKLPGSEINP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane?
The IUPAC name of imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane (CID 166562014) is imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane.
What is the SMILES notation for imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane?
The canonical SMILES for imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane is [H]N=S(C)(=O)c1cccc(COc2ncnc3cc(OC)ccc23)c1.
What is the InChIKey of imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane?
The InChIKey is YVJQJKLPGSEINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-22-13-6-7-15-16(9-13)19-11-20-17(15)23-10-12-4-3-5-14(8-12)24(2,18)21/h3-9,11,18H,10H2,1-2H3.
What are the key properties of imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane?
imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane has a molecular weight of 343.41 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for imino-[3-[(7-methoxyquinazolin-4-yl)oxymethyl]phenyl]-methyl-oxo-λ6-sulfane is sourced from PubChem (CID 166562014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).