C10H23N3OS — CID 166562016
N-(methylsulfonimidoyl)-1-(1-propan-2-ylpiperidin-4-yl)methanamine (PubChem CID 166562016) has the molecular formula C10H23N3OS and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(methylsulfonimidoyl)-1-(1-propan-2-ylpiperidin-4-yl)methanamine.
| Compound Name | N-(methylsulfonimidoyl)-1-(1-propan-2-ylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 166562016 |
| Molecular Formula | C10H23N3OS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-(methylsulfonimidoyl)-1-(1-propan-2-ylpiperidin-4-yl)methanamine |
| SMILES | [H]N=S(C)(=O)NCC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C10H23N3OS/c1-9(2)13-6-4-10(5-7-13)8-12-15(3,11)14/h9-10H,4-8H2,1-3H3,(H2,11,12,14) |
| InChIKey | IWFONOVWBBLXEG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |