About 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid
1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid (PubChem CID 166562379) has the molecular formula C10H16FNO2
and a molecular weight of 201.24 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 166562379 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN([C@@H]2CCC[C@H]2F)C1 |
| InChI | InChI=1S/C10H16FNO2/c11-8-2-1-3-9(8)12-5-4-7(6-12)10(13)14/h7-9H,1-6H2,(H,13,14)/t7?,8-,9-/m1/s1 |
| InChIKey | AMFWZNUHALRRMG-CFCGPWAMSA-N |
| XLogP | 1.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid (CID 166562379) is 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid is O=C(O)C1CCN([C@@H]2CCC[C@H]2F)C1.
What is the InChIKey of 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid?
The InChIKey is AMFWZNUHALRRMG-CFCGPWAMSA-N. The full InChI is InChI=1S/C10H16FNO2/c11-8-2-1-3-9(8)12-5-4-7(6-12)10(13)14/h7-9H,1-6H2,(H,13,14)/t7?,8-,9-/m1/s1.
What are the key properties of 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid?
1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid has a molecular weight of 201.24 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-fluorocyclopentyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 166562379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).