About methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate
methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate (PubChem CID 166562434) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate |
| PubChem CID | 166562434 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN([C@@H]2CCC[C@@H]2O)C1 |
| InChI | InChI=1S/C11H19NO3/c1-15-11(14)8-5-6-12(7-8)9-3-2-4-10(9)13/h8-10,13H,2-7H2,1H3/t8?,9-,10+/m1/s1 |
| InChIKey | IVCSPBKEXMJWOE-XVBQNVSMSA-N |
| XLogP | 0.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate (CID 166562434) is methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate is COC(=O)C1CCN([C@@H]2CCC[C@@H]2O)C1.
What is the InChIKey of methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate?
The InChIKey is IVCSPBKEXMJWOE-XVBQNVSMSA-N. The full InChI is InChI=1S/C11H19NO3/c1-15-11(14)8-5-6-12(7-8)9-3-2-4-10(9)13/h8-10,13H,2-7H2,1H3/t8?,9-,10+/m1/s1.
What are the key properties of methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate?
methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1R,2S)-2-hydroxycyclopentyl]pyrrolidine-3-carboxylate is sourced from PubChem (CID 166562434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).