1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid

C12H21NO3 — CID 166562471

IUPAC1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid
SMILESCO[C@@H]1CCCC[C@H]1N1CCC(C(=O)O)C1
InChIInChI=1S/C12H21NO3/c1-16-11-5-3-2-4-10(11)13-7-6-9(8-13)12(14)15/h9-11H,2-8H2,1H3,(H,14,15)/t9?,10-,11-/m1/s1
InChIKeyIYPHZDHMEZYHSW-FHZGLPGMSA-N
MW227.30 g/mol
LogP1.35
Rot. Bonds3

About 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid

1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid (PubChem CID 166562471) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid
PubChem CID166562471
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Name1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid
SMILESCO[C@@H]1CCCC[C@H]1N1CCC(C(=O)O)C1
InChIInChI=1S/C12H21NO3/c1-16-11-5-3-2-4-10(11)13-7-6-9(8-13)12(14)15/h9-11H,2-8H2,1H3,(H,14,15)/t9?,10-,11-/m1/s1
InChIKeyIYPHZDHMEZYHSW-FHZGLPGMSA-N
XLogP1.35
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid (CID 166562471) is 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid is CO[C@@H]1CCCC[C@H]1N1CCC(C(=O)O)C1.
What is the InChIKey of 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid?
The InChIKey is IYPHZDHMEZYHSW-FHZGLPGMSA-N. The full InChI is InChI=1S/C12H21NO3/c1-16-11-5-3-2-4-10(11)13-7-6-9(8-13)12(14)15/h9-11H,2-8H2,1H3,(H,14,15)/t9?,10-,11-/m1/s1.
What are the key properties of 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid?
1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid has a molecular weight of 227.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-methoxycyclohexyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 166562471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).