C24H29NO4S — CID 16656251
(2R,5S)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-5-pentyl-2,5-dihydropyrrole-3-carboxylic acid (PubChem CID 16656251) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2R,5S)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-5-pentyl-2,5-dihydropyrrole-3-carboxylic acid.
| Compound Name | (2R,5S)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-5-pentyl-2,5-dihydropyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 16656251 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2R,5S)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-5-pentyl-2,5-dihydropyrrole-3-carboxylic acid |
| SMILES | CCCCC[C@H]1C=C(C(=O)O)[C@@H](c2ccc(C)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-4-5-6-7-20-16-22(24(26)27)23(19-12-8-17(2)9-13-19)25(20)30(28,29)21-14-10-18(3)11-15-21/h8-16,20,23H,4-7H2,1-3H3,(H,26,27)/t20-,23+/m0/s1 |
| InChIKey | FYDZYZIHFURHFW-NZQKXSOJSA-N |
| XLogP | 5.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|