C25H21ClN2O6S — CID 16656253
(2S,6S)-6-(3-chlorophenyl)-2-(4-methylphenyl)-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid (PubChem CID 16656253) has the molecular formula C25H21ClN2O6S and a molecular weight of 512.97 g/mol. Its IUPAC name is (2S,6S)-6-(3-chlorophenyl)-2-(4-methylphenyl)-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid.
| Compound Name | (2S,6S)-6-(3-chlorophenyl)-2-(4-methylphenyl)-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 16656253 |
| Molecular Formula | C25H21ClN2O6S |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | (2S,6S)-6-(3-chlorophenyl)-2-(4-methylphenyl)-1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| SMILES | Cc1ccc([C@@H]2CC=C(C(=O)O)[C@H](c3cccc(Cl)c3)N2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H21ClN2O6S/c1-16-5-7-17(8-6-16)23-14-13-22(25(29)30)24(18-3-2-4-19(26)15-18)27(23)35(33,34)21-11-9-20(10-12-21)28(31)32/h2-13,15,23-24H,14H2,1H3,(H,29,30)/t23-,24-/m0/s1 |
| InChIKey | KMRFAPUWQGREIG-ZEQRLZLVSA-N |
| XLogP | 5.44 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|