C19H20N6 — CID 166562919
4-[(Z)-2-[5-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]-1-isocyanoethenyl]benzonitrile (PubChem CID 166562919) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-[(Z)-2-[5-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]-1-isocyanoethenyl]benzonitrile.
| Compound Name | 4-[(Z)-2-[5-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]-1-isocyanoethenyl]benzonitrile |
|---|---|
| PubChem CID | 166562919 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[(Z)-2-[5-[2-(dimethylamino)ethyl-methylamino]pyrimidin-2-yl]-1-isocyanoethenyl]benzonitrile |
| SMILES | [C-]#[N+]/C(=C\c1ncc(N(C)CCN(C)C)cn1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H20N6/c1-21-18(16-7-5-15(12-20)6-8-16)11-19-22-13-17(14-23-19)25(4)10-9-24(2)3/h5-8,11,13-14H,9-10H2,2-4H3/b18-11- |
| InChIKey | RUPRDZBGKLYTDB-WQRHYEAKSA-N |
| XLogP | 2.76 |
| TPSA | 60.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|