About 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine
8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 166563495) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine |
| PubChem CID | 166563495 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)C1=CC=CN2CCN=C12 |
| InChI | InChI=1S/C11H16N2/c1-11(2,3)9-5-4-7-13-8-6-12-10(9)13/h4-5,7H,6,8H2,1-3H3 |
| InChIKey | HGZBLJNWZLDTMY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine (CID 166563495) is 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine is CC(C)(C)C1=CC=CN2CCN=C12.
What is the InChIKey of 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine?
The InChIKey is HGZBLJNWZLDTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-11(2,3)9-5-4-7-13-8-6-12-10(9)13/h4-5,7H,6,8H2,1-3H3.
What are the key properties of 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine?
8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine has a molecular weight of 176.26 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-2,3-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 166563495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).