About (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide
(3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide (PubChem CID 166564461) has the molecular formula C11H12ClF2NO2S
and a molecular weight of 295.74 g/mol. Its IUPAC name is (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide.
Molecular Properties
| Compound Name | (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide |
| PubChem CID | 166564461 |
| Molecular Formula | C11H12ClF2NO2S |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide |
| SMILES | C[C@@H]1CS(=O)(=O)CC[C@@]1(F)c1cc(Cl)cnc1F |
| InChI | InChI=1S/C11H12ClF2NO2S/c1-7-6-18(16,17)3-2-11(7,14)9-4-8(12)5-15-10(9)13/h4-5,7H,2-3,6H2,1H3/t7-,11+/m1/s1 |
| InChIKey | OLVWRTWRUFPTFQ-HQJQHLMTSA-N |
| XLogP | 2.49 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide?
The IUPAC name of (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide (CID 166564461) is (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide.
What is the SMILES notation for (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide?
The canonical SMILES for (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide is C[C@@H]1CS(=O)(=O)CC[C@@]1(F)c1cc(Cl)cnc1F.
What is the InChIKey of (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide?
The InChIKey is OLVWRTWRUFPTFQ-HQJQHLMTSA-N. The full InChI is InChI=1S/C11H12ClF2NO2S/c1-7-6-18(16,17)3-2-11(7,14)9-4-8(12)5-15-10(9)13/h4-5,7H,2-3,6H2,1H3/t7-,11+/m1/s1.
What are the key properties of (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide?
(3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide has a molecular weight of 295.74 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylthiane 1,1-dioxide is sourced from PubChem (CID 166564461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).