About CID 166564504
CID 166564504 (PubChem CID 166564504) has the molecular formula C58H41N3O2
and a molecular weight of 811.99 g/mol.
Molecular Properties
| Compound Name | CID 166564504 |
| PubChem CID | 166564504 |
| Molecular Formula | C58H41N3O2 |
| Molecular Weight | 811.99 g/mol |
| Exact Mass | 811.32 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2ccccc2-c2cccc3c2-[n+]2[c-]n(-c4cccc(Oc5ccc6c(c5)oc5ccccc56)c4)c4cccc(c42)-c2ccccc2-c2ccccc2-3)c1 |
| InChI | InChI=1S/C58H41N3O2/c1-58(2,3)37-31-32-59-52(33-37)46-22-9-8-21-45(46)50-25-13-24-49-43-19-6-4-17-41(43)42-18-5-7-20-44(42)51-26-14-27-53-57(51)61(56(49)50)36-60(53)38-15-12-16-39(34-38)62-40-29-30-48-47-23-10-11-28-54(47)63-55(48)35-40/h4-35H,1-3H3 |
| InChIKey | AGGAVQMPQQKHTG-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 811.99 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166564504 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166564504?
The IUPAC name of CID 166564504 (CID 166564504) is not available.
What is the SMILES notation for CID 166564504?
The canonical SMILES for CID 166564504 is CC(C)(C)c1ccnc(-c2ccccc2-c2cccc3c2-[n+]2[c-]n(-c4cccc(Oc5ccc6c(c5)oc5ccccc56)c4)c4cccc(c42)-c2ccccc2-c2ccccc2-3)c1.
What is the InChIKey of CID 166564504?
The InChIKey is AGGAVQMPQQKHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C58H41N3O2/c1-58(2,3)37-31-32-59-52(33-37)46-22-9-8-21-45(46)50-25-13-24-49-43-19-6-4-17-41(43)42-18-5-7-20-44(42)51-26-14-27-53-57(51)61(56(49)50)36-60(53)38-15-12-16-39(34-38)62-40-29-30-48-47-23-10-11-28-54(47)63-55(48)35-40/h4-35H,1-3H3.
What are the key properties of CID 166564504?
CID 166564504 has a molecular weight of 811.99 g/mol, XLogP of 14.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166564504 is sourced from PubChem (CID 166564504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).