C20H15F2N7O3S — CID 166565105
5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-N-(3,4-difluorophenyl)-2-hydroxybenzamide (PubChem CID 166565105) has the molecular formula C20H15F2N7O3S and a molecular weight of 471.45 g/mol. Its IUPAC name is 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-N-(3,4-difluorophenyl)-2-hydroxybenzamide.
| Compound Name | 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-N-(3,4-difluorophenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 166565105 |
| Molecular Formula | C20H15F2N7O3S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-N-(3,4-difluorophenyl)-2-hydroxybenzamide |
| SMILES | Nc1nc(SCC(=O)Nc2ccc(O)c(C(=O)Nc3ccc(F)c(F)c3)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C20H15F2N7O3S/c21-12-3-1-10(6-13(12)22)27-18(32)11-5-9(2-4-14(11)30)26-15(31)7-33-19-16-17(25-8-24-16)28-20(23)29-19/h1-6,8,30H,7H2,(H,26,31)(H,27,32)(H3,23,24,25,28,29) |
| InChIKey | DHTUWKDZAUTPNK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|