C13H13N7O2S — CID 166565225
N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 166565225) has the molecular formula C13H13N7O2S and a molecular weight of 331.36 g/mol. Its IUPAC name is N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166565225 |
| Molecular Formula | C13H13N7O2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethyl]-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | Nc1nc(SCCNC(=O)c2cc(=O)cc[nH]2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H13N7O2S/c14-13-19-10-9(17-6-18-10)12(20-13)23-4-3-16-11(22)8-5-7(21)1-2-15-8/h1-2,5-6H,3-4H2,(H,15,21)(H,16,22)(H3,14,17,18,19,20) |
| InChIKey | GRANACPGQGCHBR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|