C29H24O9 — CID 16656643
3,7,15,19,21,24-hexahydroxy-24-methyl-7-propyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(26),2,4(9),10,12,14,16(25),18(23),19,21-decaene-5,17-dione (PubChem CID 16656643) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is 3,7,15,19,21,24-hexahydroxy-24-methyl-7-propyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(26),2,4(9),10,12,14,16(25),18(23),19,21-decaene-5,17-dione.
| Compound Name | 3,7,15,19,21,24-hexahydroxy-24-methyl-7-propyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(26),2,4(9),10,12,14,16(25),18(23),19,21-decaene-5,17-dione |
|---|---|
| PubChem CID | 16656643 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 3,7,15,19,21,24-hexahydroxy-24-methyl-7-propyl-6-oxahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(26),2,4(9),10,12,14,16(25),18(23),19,21-decaene-5,17-dione |
| SMILES | CCCC1(O)Cc2cc3ccc4c(O)c5c(cc4c3c(O)c2C(=O)O1)C(C)(O)c1cc(O)cc(O)c1C5=O |
| InChI | InChI=1S/C29H24O9/c1-3-6-29(37)11-13-7-12-4-5-15-16(20(12)25(33)21(13)27(35)38-29)10-18-23(24(15)32)26(34)22-17(28(18,2)36)8-14(30)9-19(22)31/h4-5,7-10,30-33,36-37H,3,6,11H2,1-2H3 |
| InChIKey | ZUJFIGHDWAPKMX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|