C12H28N2Sn — CID 166567561
2,2-diethyl-1,3-di(propan-2-yl)-1,3,2-diazastannolidine (PubChem CID 166567561) has the molecular formula C12H28N2Sn and a molecular weight of 319.08 g/mol. Its IUPAC name is 2,2-diethyl-1,3-di(propan-2-yl)-1,3,2-diazastannolidine.
| Compound Name | 2,2-diethyl-1,3-di(propan-2-yl)-1,3,2-diazastannolidine |
|---|---|
| PubChem CID | 166567561 |
| Molecular Formula | C12H28N2Sn |
| Molecular Weight | 319.08 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2,2-diethyl-1,3-di(propan-2-yl)-1,3,2-diazastannolidine |
| SMILES | CC[Sn]1(CC)N(C(C)C)CCN1C(C)C |
| InChI | InChI=1S/C8H18N2.2C2H5.Sn/c1-7(2)9-5-6-10-8(3)4;2*1-2;/h7-8H,5-6H2,1-4H3;2*1H2,2H3;/q-2;;;+2 |
| InChIKey | MAPZGODUYSFQBN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.08 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |