C53H35N3 — CID 166568654
8-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]-1,3-diphenylbenzo[f]quinoline (PubChem CID 166568654) has the molecular formula C53H35N3 and a molecular weight of 713.88 g/mol. Its IUPAC name is 8-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]-1,3-diphenylbenzo[f]quinoline.
| Compound Name | 8-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]-1,3-diphenylbenzo[f]quinoline |
|---|---|
| PubChem CID | 166568654 |
| Molecular Formula | C53H35N3 |
| Molecular Weight | 713.88 g/mol |
| Exact Mass | 713.28 |
| IUPAC Name | 8-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]-1,3-diphenylbenzo[f]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc5c(ccc6nc(-c7ccccc7)cc(-c7ccccc7)c65)c4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C53H35N3/c1-6-16-36(17-7-1)43-31-44(37-18-8-2-9-19-37)33-45(32-43)51-35-50(55-53(56-51)40-24-14-5-15-25-40)42-26-28-46-41(30-42)27-29-48-52(46)47(38-20-10-3-11-21-38)34-49(54-48)39-22-12-4-13-23-39/h1-35H |
| InChIKey | GPTVNQBHVUZFKI-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.88 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|