C10H19NO — CID 166569576
1,3,3-trimethyl-3a,4,5,6,7,7a-hexahydro-2,1-benzoxazole (PubChem CID 166569576) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 1,3,3-trimethyl-3a,4,5,6,7,7a-hexahydro-2,1-benzoxazole.
| Compound Name | 1,3,3-trimethyl-3a,4,5,6,7,7a-hexahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 166569576 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1,3,3-trimethyl-3a,4,5,6,7,7a-hexahydro-2,1-benzoxazole |
| SMILES | CN1OC(C)(C)C2CCCCC21 |
| InChI | InChI=1S/C10H19NO/c1-10(2)8-6-4-5-7-9(8)11(3)12-10/h8-9H,4-7H2,1-3H3 |
| InChIKey | ASZSQVBUIPSDEV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |