methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate

C10H16O3 — CID 166569735

IUPACmethyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate
SMILESCOC(=O)CC1(C)CCC(=O)C1C
InChIInChI=1S/C10H16O3/c1-7-8(11)4-5-10(7,2)6-9(12)13-3/h7H,4-6H2,1-3H3
InChIKeyDXWJVFNAUVZEKL-UHFFFAOYSA-N
MW184.23 g/mol
LogP1.55
Rot. Bonds2

About methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate

methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate (PubChem CID 166569735) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate.

Molecular Properties

Compound Namemethyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate
PubChem CID166569735
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Namemethyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate
SMILESCOC(=O)CC1(C)CCC(=O)C1C
InChIInChI=1S/C10H16O3/c1-7-8(11)4-5-10(7,2)6-9(12)13-3/h7H,4-6H2,1-3H3
InChIKeyDXWJVFNAUVZEKL-UHFFFAOYSA-N
XLogP1.55
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 51.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate?
The IUPAC name of methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate (CID 166569735) is methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate.
What is the SMILES notation for methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate?
The canonical SMILES for methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate is COC(=O)CC1(C)CCC(=O)C1C.
What is the InChIKey of methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate?
The InChIKey is DXWJVFNAUVZEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-7-8(11)4-5-10(7,2)6-9(12)13-3/h7H,4-6H2,1-3H3.
What are the key properties of methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate?
methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate has a molecular weight of 184.23 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,2-dimethyl-3-oxocyclopentyl)acetate is sourced from PubChem (CID 166569735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).