C27H28IrN2O2-2 — CID 166570249
4-(3,5-dimethylbenzene-6-id-1-yl)furo[3,2-c]quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide (PubChem CID 166570249) has the molecular formula C27H28IrN2O2-2 and a molecular weight of 604.75 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)furo[3,2-c]quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)furo[3,2-c]quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide |
|---|---|
| PubChem CID | 166570249 |
| Molecular Formula | C27H28IrN2O2-2 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)furo[3,2-c]quinoline;iridium;[(Z)-4-oxopent-2-en-2-yl]-propan-2-ylazanide |
| SMILES | CC(=O)/C=C(/C)[N-]C(C)C.Cc1[c-]c(-c2nc3ccccc3c3occc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C19H14NO.C8H15NO.Ir/c1-12-9-13(2)11-14(10-12)18-16-7-8-21-19(16)15-5-3-4-6-17(15)20-18;1-6(2)9-7(3)5-8(4)10;/h3-10H,1-2H3;5-6H,1-4H3,(H,9,10);/q-1;;/p-1 |
| InChIKey | NBRCMWPJUAOGQB-UHFFFAOYSA-M |
| XLogP | 7.32 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|