C45H58IrNO3- — CID 166570350
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(2-methylpropyl)furo[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium (PubChem CID 166570350) has the molecular formula C45H58IrNO3- and a molecular weight of 853.18 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(2-methylpropyl)furo[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(2-methylpropyl)furo[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166570350 |
| Molecular Formula | C45H58IrNO3- |
| Molecular Weight | 853.18 g/mol |
| Exact Mass | 853.41 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(2-methylpropyl)furo[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1c(CC(C)C)oc2c1c(-c1[c-]c3ccccc3c(C(C)(C)C)c1)nc1ccccc12.[Ir] |
| InChI | InChI=1S/C30H30NO.C15H28O2.Ir/c1-18(2)15-26-19(3)27-28(31-25-14-10-9-13-23(25)29(27)32-26)21-16-20-11-7-8-12-22(20)24(17-21)30(4,5)6;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h7-14,17-18H,15H2,1-6H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | WWUMUEFPNAQEHY-SWPBDETKSA-N |
| XLogP | 13.05 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.18 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|