C44H56IrNO2S- — CID 166570366
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7,9-dimethyl-2-(2-methylpropyl)thieno[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 166570366) has the molecular formula C44H56IrNO2S- and a molecular weight of 855.22 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7,9-dimethyl-2-(2-methylpropyl)thieno[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7,9-dimethyl-2-(2-methylpropyl)thieno[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166570366 |
| Molecular Formula | C44H56IrNO2S- |
| Molecular Weight | 855.22 g/mol |
| Exact Mass | 855.37 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7,9-dimethyl-2-(2-methylpropyl)thieno[3,2-c]quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c2c(c1)nc(-c1[c-]c3ccccc3c(C(C)(C)C)c1)c1cc(CC(C)C)sc12.[Ir] |
| InChI | InChI=1S/C31H32NS.C13H24O2.Ir/c1-18(2)12-23-17-25-29(32-27-14-19(3)13-20(4)28(27)30(25)33-23)22-15-21-10-8-9-11-24(21)26(16-22)31(5,6)7;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-11,13-14,16-18H,12H2,1-7H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | NBIVZSWZPKMDQZ-DZTQYQPZSA-N |
| XLogP | 13.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.22 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|