C42H26N4OPtS — CID 166570723
CID 166570723 (PubChem CID 166570723) has the molecular formula C42H26N4OPtS and a molecular weight of 829.84 g/mol.
| Compound Name | CID 166570723 |
|---|---|
| PubChem CID | 166570723 |
| Molecular Formula | C42H26N4OPtS |
| Molecular Weight | 829.84 g/mol |
| Exact Mass | 829.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)oc1cnc(-c3[c-]c4c(cc3)c3cccc5c6ccc(-c7nccc8sc9ccccc9c78)[c-]c6n4c53)n12.[Pt+2] |
| InChI | InChI=1S/C42H26N4OS.Pt/c1-42(2,3)25-13-16-31-34(21-25)47-37-22-44-41(46(31)37)24-12-15-27-29-9-6-8-28-26-14-11-23(19-32(26)45(40(28)29)33(27)20-24)39-38-30-7-4-5-10-35(30)48-36(38)17-18-43-39;/h4-18,21-22H,1-3H3;/q-2;+2 |
| InChIKey | QIXMJAKHRQBZKQ-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 47.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.84 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|