About [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate
[1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate (PubChem CID 166570829) has the molecular formula C12H19F3O4S
and a molecular weight of 316.34 g/mol. Its IUPAC name is [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate.
Molecular Properties
| Compound Name | [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate |
| PubChem CID | 166570829 |
| Molecular Formula | C12H19F3O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1(C(F)(F)F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19F3O4S/c1-3-9(2)10(16)19-8-11(12(13,14)15)4-6-20(17,18)7-5-11/h9H,3-8H2,1-2H3 |
| InChIKey | LSMVRVIEKKQPHR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate?
The IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate (CID 166570829) is [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate.
What is the SMILES notation for [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate?
The canonical SMILES for [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate is CCC(C)C(=O)OCC1(C(F)(F)F)CCS(=O)(=O)CC1.
What is the InChIKey of [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate?
The InChIKey is LSMVRVIEKKQPHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O4S/c1-3-9(2)10(16)19-8-11(12(13,14)15)4-6-20(17,18)7-5-11/h9H,3-8H2,1-2H3.
What are the key properties of [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate?
[1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate has a molecular weight of 316.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-4-(trifluoromethyl)thian-4-yl]methyl 2-methylbutanoate is sourced from PubChem (CID 166570829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).