About 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid
4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid (PubChem CID 16657104) has the molecular formula C21H12N2O8S
and a molecular weight of 452.40 g/mol. Its IUPAC name is 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid |
| PubChem CID | 16657104 |
| Molecular Formula | C21H12N2O8S |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid |
| SMILES | [H]/N=N\c1ccc(C(=O)O)c(O)c1-c1c(S(=O)(=O)O)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H12N2O8S/c22-23-13-7-5-12(21(27)28)20(26)16(13)17-14(32(29,30)31)8-6-11-15(17)19(25)10-4-2-1-3-9(10)18(11)24/h1-8,22,26H,(H,27,28)(H,29,30,31)/b23-22- |
| InChIKey | XZFWTBFHXULOOS-FCQUAONHSA-N |
| XLogP | 3.44 |
| TPSA | 182.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid?
The IUPAC name of 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid (CID 16657104) is 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid.
What is the SMILES notation for 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid?
The canonical SMILES for 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid is [H]/N=N\c1ccc(C(=O)O)c(O)c1-c1c(S(=O)(=O)O)ccc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid?
The InChIKey is XZFWTBFHXULOOS-FCQUAONHSA-N. The full InChI is InChI=1S/C21H12N2O8S/c22-23-13-7-5-12(21(27)28)20(26)16(13)17-14(32(29,30)31)8-6-11-15(17)19(25)10-4-2-1-3-9(10)18(11)24/h1-8,22,26H,(H,27,28)(H,29,30,31)/b23-22-.
What are the key properties of 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid?
4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid has a molecular weight of 452.40 g/mol, XLogP of 3.44, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenyl-3-(9,10-dioxo-2-sulfoanthracen-1-yl)-2-hydroxybenzoic acid is sourced from PubChem (CID 16657104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).