C21H18F3N3O4 — CID 16657121
2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-3,3,3-trifluoropropanamide (PubChem CID 16657121) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-3,3,3-trifluoropropanamide.
| Compound Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 16657121 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-3,3,3-trifluoropropanamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OC(C(N)=O)C(F)(F)F)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H18F3N3O4/c1-11-15(17(28)19(25)29)16-13(27(11)10-12-6-3-2-4-7-12)8-5-9-14(16)31-18(20(26)30)21(22,23)24/h2-9,18H,10H2,1H3,(H2,25,29)(H2,26,30) |
| InChIKey | WOTJPZOAEDAXCS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|