C57H39N3 — CID 166571456
2-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 166571456) has the molecular formula C57H39N3 and a molecular weight of 765.96 g/mol. Its IUPAC name is 2-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166571456 |
| Molecular Formula | C57H39N3 |
| Molecular Weight | 765.96 g/mol |
| Exact Mass | 765.31 |
| IUPAC Name | 2-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6cccc(-c7cc(-c8ccccc8)cc(-c8ccccc8)c7)c6)c5)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H39N3/c1-5-15-40(16-6-1)43-27-29-44(30-28-43)45-31-33-47(34-32-45)56-58-55(46-21-11-4-12-22-46)59-57(60-56)51-26-14-24-49(36-51)48-23-13-25-50(35-48)54-38-52(41-17-7-2-8-18-41)37-53(39-54)42-19-9-3-10-20-42/h1-39H |
| InChIKey | WNQKANVAHYRLBU-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.96 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |