C28H28N2O12S3-2 — CID 166571485
3-carboxy-4-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfonatopropylamino)xanthen-9-yl]benzenesulfonate (PubChem CID 166571485) has the molecular formula C28H28N2O12S3-2 and a molecular weight of 680.73 g/mol. Its IUPAC name is 3-carboxy-4-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfonatopropylamino)xanthen-9-yl]benzenesulfonate.
| Compound Name | 3-carboxy-4-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfonatopropylamino)xanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 166571485 |
| Molecular Formula | C28H28N2O12S3-2 |
| Molecular Weight | 680.73 g/mol |
| Exact Mass | 680.08 |
| IUPAC Name | 3-carboxy-4-[2,7-dimethyl-3-(3-sulfanyloxyperoxypropylimino)-6-(3-sulfonatopropylamino)xanthen-9-yl]benzenesulfonate |
| SMILES | Cc1cc2c(-c3ccc(S(=O)(=O)[O-])cc3C(=O)O)c3cc(C)/c(=N/CCCOOOS)cc-3oc2cc1NCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H30N2O12S3/c1-16-11-21-25(14-23(16)29-7-3-9-39-41-42-43)40-26-15-24(30-8-4-10-44(33,34)35)17(2)12-22(26)27(21)19-6-5-18(45(36,37)38)13-20(19)28(31)32/h5-6,11-15,30,43H,3-4,7-10H2,1-2H3,(H,31,32)(H,33,34,35)(H,36,37,38)/p-2/b29-23+ |
| InChIKey | SEPMVOXZBHUCRW-BYNJWEBRSA-L |
| XLogP | 3.79 |
| TPSA | 216.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|