About 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine
6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 166571557) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 166571557 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC1=CC2NC=C(C(C)C)C2C=N1 |
| InChI | InChI=1S/C11H16N2/c1-7(2)9-5-13-11-4-8(3)12-6-10(9)11/h4-7,10-11,13H,1-3H3 |
| InChIKey | GQRYBTMYUKRLJF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine (CID 166571557) is 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine is CC1=CC2NC=C(C(C)C)C2C=N1.
What is the InChIKey of 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is GQRYBTMYUKRLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-7(2)9-5-13-11-4-8(3)12-6-10(9)11/h4-7,10-11,13H,1-3H3.
What are the key properties of 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine?
6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 176.26 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 166571557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).