C21H17F4N3O4 — CID 16657183
2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,3,3,3-tetrafluoropropanamide (PubChem CID 16657183) has the molecular formula C21H17F4N3O4 and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,3,3,3-tetrafluoropropanamide.
| Compound Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,3,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 16657183 |
| Molecular Formula | C21H17F4N3O4 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-(1-benzyl-2-methyl-3-oxamoylindol-4-yl)oxy-2,3,3,3-tetrafluoropropanamide |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OC(F)(C(N)=O)C(F)(F)F)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H17F4N3O4/c1-11-15(17(29)18(26)30)16-13(28(11)10-12-6-3-2-4-7-12)8-5-9-14(16)32-20(22,19(27)31)21(23,24)25/h2-9H,10H2,1H3,(H2,26,30)(H2,27,31) |
| InChIKey | JFEJVWMOWTUBRY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|