C18H26N2O2 — CID 166572022
[4-[(5-tert-butyl-2-pyridinyl)oxy]piperidin-1-yl]-cyclopropylmethanone (PubChem CID 166572022) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [4-[(5-tert-butyl-2-pyridinyl)oxy]piperidin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[(5-tert-butyl-2-pyridinyl)oxy]piperidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 166572022 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [4-[(5-tert-butyl-2-pyridinyl)oxy]piperidin-1-yl]-cyclopropylmethanone |
| SMILES | CC(C)(C)c1ccc(OC2CCN(C(=O)C3CC3)CC2)nc1 |
| InChI | InChI=1S/C18H26N2O2/c1-18(2,3)14-6-7-16(19-12-14)22-15-8-10-20(11-9-15)17(21)13-4-5-13/h6-7,12-13,15H,4-5,8-11H2,1-3H3 |
| InChIKey | VWLXOUJUPCIMSK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |