C50H34N4 — CID 166572260
3,5-bis(12,12-dimethylindeno[1,2-c]carbazol-5-yl)benzene-1,2-dicarbonitrile (PubChem CID 166572260) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 3,5-bis(12,12-dimethylindeno[1,2-c]carbazol-5-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 3,5-bis(12,12-dimethylindeno[1,2-c]carbazol-5-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 166572260 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 3,5-bis(12,12-dimethylindeno[1,2-c]carbazol-5-yl)benzene-1,2-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2-c2ccc3c(c21)c1ccccc1n3-c1cc(C#N)c(C#N)c(-n2c3ccccc3c3c4c(ccc32)-c2ccccc2C4(C)C)c1 |
| InChI | InChI=1S/C50H34N4/c1-49(2)38-17-9-5-13-31(38)33-21-23-42-45(47(33)49)35-15-7-11-19-40(35)53(42)30-25-29(27-51)37(28-52)44(26-30)54-41-20-12-8-16-36(41)46-43(54)24-22-34-32-14-6-10-18-39(32)50(3,4)48(34)46/h5-26H,1-4H3 |
| InChIKey | JRPBAOUBRWUYAX-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |